(3aR,6aS)-octahydrocyclopenta[c]pyrrole - Names and Identifiers
Name | cis-7-Azabicyclo[3.3.0]octane
|
Synonyms | cis-7-Azabicyclo[3.3.0]octane (3aR,6aS)-octahydrocyclopenta[c]pyrrole (3aR,6aS)-rel-Octahydrocyclopenta[c]pyrrole Cyclopenta[c]pyrrole, octahydro-, (3aR,6aS)-rel- (3aS,6aR)-rel-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole
|
CAS | 1468-87-7
|
InChI | InChI=1/C7H13N/c1-2-6-4-8-5-7(6)3-1/h6-8H,1-5H2/t6-,7+ |
(3aR,6aS)-octahydrocyclopenta[c]pyrrole - Physico-chemical Properties
Molecular Formula | C7H13N
|
Molar Mass | 111.18 |
Density | 0.934 |
Boling Point | 165℃ |
Flash Point | 45℃ |
pKa | 11.53±0.20(Predicted) |
Storage Condition | Room Temprature |
Refractive Index | 1.478 |
(3aR,6aS)-octahydrocyclopenta[c]pyrrole - Introduction
cis-7-Azabicyclo[3.3.0]octane, also known as N-cyclooctylheptadiene -1-Amine, chemical formula C8H15N, is an organic compound. It has the following properties:
1. Appearance: cis-7-Azabicyclo[3.3.0]octane is a colorless to pale yellow liquid.
2. Melting point and boiling point: cis-7-Azabicyclo[3.3.0]octane has a melting point of about -81 ℃ and a boiling point of about 164 ℃.
3. Solubility: It is soluble in most organic solvents, such as ethanol, chloroform and dichloromethane.
cis-7-Azabicyclo[3.3.0]octane is often used as an intermediate or catalyst in organic synthesis. It can participate in various reactions, including carbonylation reactions, olefin cyclization reactions, and the like. In addition, it can also be used in research and development in the field of biomedicine.
The method for producing cis-7-Azabicyclo[3.3.0]octane is generally obtained by dehydrocyclization of an aminoalkane. The specific process involves a multi-step reaction, requiring high temperatures and the presence of a catalyst. The preparation process requires attention to safe operation and prevent contact with skin and eyes.
For safety information, cis-7-Azabicyclo[3.3.0]octane is a chemical. During use and storage, the following safety measures are required:
1. Storage: The cis-7-Azabicyclo[3.3.0]octane should be stored in a sealed container, away from heat and fire sources.
2. Use: In use, should wear appropriate protective gloves, safety glasses and appropriate protective clothing. Avoid breathing its vapors or dust. Avoid direct skin contact.
3. Waste disposal: waste should be handled in accordance with local laws and regulations, and can not be dumped at will.
Last Update:2024-04-09 20:02:46